"""
Code to calculate spin-orbit spillage.
Reference:
https://www.nature.com/articles/s41598-019-45028-y
https://www.nature.com/articles/s41524-020-0319-4
https://arxiv.org/abs/2102.00237
"""
import numpy as np
from jarvis.io.vasp.outputs import Wavecar # vaspwfc
[docs]class Spillage(object):
"""
Spin-orbit spillage criteria.
Predict whether a material is topologically non-trival.
The spillage criteria physically signifies
number of band-inverted electrons.
A non-zero, high value (generally >0.5) suggests non-trivial behavior
"""
def __init__(self, wf_noso="", wf_so=""):
"""
Require path to WAVECAR files with and without LSORBIT = .TRUE.
Args:
wf_noso : WAVECAR without spin-orbit coupling
wf_so : WAVECAR with spin-orbit coupling
"""
self.wf_noso = wf_noso
self.wf_so = wf_so
[docs] def isclose(self, n1, n2, rel_tol=1e-7):
"""Check if n1 and n2 are close."""
if abs(n1 - n2) < rel_tol:
return True
else:
return False
[docs] def orth(self, A):
"""Orthogonalize a vector."""
# As we do not store overlap matrix, we orthogonalize the
# Wavefunctions.
u, s, vh = np.linalg.svd(A, full_matrices=False)
M, N = A.shape
eps = np.finfo(float).eps
tol = max(M, N) * np.amax(s) * eps
num = np.sum(s > tol, dtype=int)
Q = u[:, :num]
return Q, num
[docs] def overlap_so_spinpol(self):
"""Calculate spillage."""
noso = Wavecar(filename=self.wf_noso, lsorbit=False)
so = Wavecar(filename=self.wf_so, lsorbit=True)
# band gap stuff. not needed per se, just a useful sanity check
noso_k, noso_bands = noso.readWFBand()
so_k, so_bands = so.readWFBand()
# Calculate the number of occupied bands in non-soc calculation
# at each k-point
# Start from deep energy levels and then finds
# first unoccupied bands with occupation less than 50%
# noso._kvecs[nk1 - 1, :]: number of kpoints are rows,
# number of columns three, kpoint units
nelec_list = []
for nk1 in range(1, noso._nkpts + 1): # no spin orbit kpoints loop
knoso = noso._kvecs[nk1 - 1, :]
for nk2 in range(1, so._nkpts + 1): # spin orbit
kso = so._kvecs[nk2 - 1, :]
if (
self.isclose(kso[0], knoso[0])
and self.isclose(kso[1], knoso[1])
and self.isclose(kso[2], knoso[2])
): # do kpoints match?
if nk1 == nk2:
for c, e in enumerate(noso._occs[0, nk1 - 1, :]):
if e < 0.5:
cup = c
break
for c, e in enumerate(noso._occs[1, nk1 - 1, :]):
if e < 0.5:
cdn = c
break
nelec_list.append([cup, cdn, cup + cdn])
# total number of occupied bands at k point nk1
n_arr = np.array(nelec_list)
n_up = int(round(np.mean(n_arr[:, 0])))
n_dn = int(round(np.mean(n_arr[:, 1])))
n_tot = int(round(np.mean(n_arr[:, 2])))
nelec = int(n_tot)
# noso_homo_up = np.max(noso_bands[0, :, n_up - 1])
# noso_lumo_up = np.min(noso_bands[0, :, n_up])
# noso_homo_dn = np.max(noso_bands[1, :, n_dn - 1])
# noso_lumo_dn = np.min(noso_bands[1, :, n_dn])
so_homo = np.max(so_bands[0, :, nelec - 1])
so_lumo = np.min(so_bands[0, :, nelec])
# noso_direct_up = np.min(noso_bands[0, :, n_up] -
# noso_bands[0, :, n_up - 1])
# noso_direct_dn = np.min(noso_bands[1, :, n_dn] -
# noso_bands[1, :, n_dn - 1])
so_direct = np.min(so_bands[0, :, nelec] - so_bands[0, :, nelec - 1])
noso_direct = 1000000.0
noso_homo = -10000000.0
noso_lumo = 100000000.0
for i in range(noso_bands.shape[1]):
homo_k = max(
noso_bands[0, i, n_up - 1], noso_bands[1, i, n_dn - 1]
)
lumo_k = min(noso_bands[0, i, n_up], noso_bands[1, i, n_dn])
noso_direct = min(noso_direct, lumo_k - homo_k)
noso_homo = max(noso_homo, homo_k)
noso_lumo = min(noso_lumo, lumo_k)
gamma_k = []
kpoints = []
np.set_printoptions(precision=4)
x = []
y = []
nelec_tot = 0.0
for nk1 in range(1, noso._nkpts + 1): # no spin orbit kpoints loop
knoso = noso._kvecs[nk1 - 1, :]
for nk2 in range(1, so._nkpts + 1): # spin orbit
kso = so._kvecs[nk2 - 1, :]
if (
self.isclose(kso[0], knoso[0])
and self.isclose(kso[1], knoso[1])
and self.isclose(kso[2], knoso[2])
): # do kpoints match?
# changes section 2
if nk1 == nk2:
nelec_up = n_arr[nk1 - 1, 0]
nelec_dn = n_arr[nk1 - 1, 1]
nelec_tot = n_arr[nk1 - 1, 2]
gamma_k.append(nelec_tot)
kpoints.append(kso)
Mmn = 0.0
vnoso = noso.readBandCoeff(
ispin=1, ikpt=nk1, iband=1, norm=False
)
# Getting size of matrices
n_noso1 = vnoso.shape[0]
# number of plane waves in noso
vnoso = noso.readBandCoeff(
ispin=2, ikpt=nk1, iband=1, norm=False
)
# spin, kpt, bands, number of plane wave
# n_noso2 = vnoso.shape[0]
vso = so.readBandCoeff(
ispin=1, ikpt=nk2, iband=1, norm=False
)
n_so = vso.shape[0] # number of plane waves in so
vs = min(n_noso1 * 2, n_so)
# Vnono,and so holds wavefunctions
Vnoso = np.zeros((vs, nelec_tot), dtype=complex)
Vso = np.zeros((vs, nelec_tot), dtype=complex)
# prepare matricies,
# putting the wavefunction coeffients
# align so that they have same structure as SOC case
# which has both spin and down together
for n1 in range(1, nelec_up + 1):
Vnoso[0 : vs // 2, n1 - 1] = noso.readBandCoeff(
ispin=1, ikpt=nk1, iband=n1, norm=False
)[0 : vs // 2]
for n1 in range(1, nelec_dn + 1):
Vnoso[
vs // 2 : vs, n1 - 1 + nelec_up
] = noso.readBandCoeff(
ispin=2, ikpt=nk1, iband=n1, norm=False
)[
0 : vs // 2
]
for n1 in range(1, nelec_tot + 1):
t = so.readBandCoeff(
ispin=1, ikpt=nk2, iband=n1, norm=False
)
Vso[0 : vs // 2, n1 - 1] = t[0 : vs // 2]
Vso[vs // 2 : vs, n1 - 1] = t[
n_so // 2 : n_so // 2 + vs // 2
]
# make orthonormal basis?
# Occupied bands, both up and down
# Generally to get wavefunctions, we have
# <psi><S><psi*>
# But as we do't have S from DFT saved
# we orthogalize the wavefunctions hoping
# they span the same space
Qnoso, num_noso = self.orth(Vnoso)
Qso, num_so = self.orth(Vso)
# evalute main expression
a = []
for n1 in range(0, nelec_tot): # noso occupied bands
v1 = Qnoso[:, n1] # number of plane waves, bands
aa = 0.0
# represents the non band-inverted electrons
for n2 in range(0, nelec_tot): # so occupied bands
v2 = Qso[:, n2]
# Inner product of a nonsoc
# and soc wavefunction
# index n1 and n2
# The inner product
# of bands with and without SOC
# will be 1 for trivial bands
# Delta function of n1 and n2 if SOC is weak
t = np.dot(np.conj(v1), v2)
Mmn += t * t.conj()
aa += (t * t.conj()).real
a.append(aa)
gamma_k[-1] -= Mmn # eq 4 in prb 90 125133
x.append(kso)
y.append(np.real(gamma_k[-1]))
if gamma_k[-1] > 0.5:
print(
"nk1 nk2 kpoint gamma_k ",
nk1,
nk2,
kso,
knoso,
np.real(gamma_k[-1]),
"!!!!!!!!!!",
)
gmax = max(np.real(gamma_k))
nkmax = np.argmax(np.real(gamma_k))
kmax = kpoints[nkmax]
print("------------------------------------")
print()
print(" INDIRECT DIRECT HOMO/LUMO (eV)")
print(
"no spin-orbit gaps",
"{:+.3f}".format(float(noso_lumo - noso_homo)),
"{:+.3f}".format(noso_direct),
" ",
[noso_homo, noso_lumo],
)
print(
"spin-orbit gaps ",
"{:+.3f}".format(float(so_lumo - so_homo)),
"{:+.3f}".format(so_direct),
" ",
[so_homo, so_lumo],
)
print()
info = {}
print("gamma max", np.real(gmax), " at k = ", kmax)
info["spillage"] = np.real(gmax)
info["spillage_k"] = np.real(gamma_k).tolist()
info["kpoints"] = [kk.tolist() for kk in kpoints]
info["kmax"] = kmax.tolist()
info["noso_direct"] = noso_direct
info["so_direct"] = so_direct
info["x_axis"] = [xx.tolist() for xx in x]
info["y_axis"] = [yy.tolist() for yy in y]
info["so_lumo"] = so_lumo
info["so_homo"] = so_homo
info["noso_lumo"] = noso_lumo
info["noso_homo"] = noso_homo
return info
# wf_so='/rk2/knc6/JARVIS-DFT/Bulk9-at30/mp-22260_PBEBO/MAIN-SOCSCFBAND-JVASP-59757_mp-22260/WAVECAR'
# wf_noso='/rk2/knc6/JARVIS-DFT/Bulk9-at30/mp-22260_PBEBO/MAIN-MAGSCFBAND-JVASP-59757_mp-22260/WAVECAR'
# spl = Spillage(wf_noso=wf_noso, wf_so=wf_so)
# info = spl.overlap_so_spinpol()
"""
if __name__ == "__main__":
# JVASP-1044
wf_noso = "../../tests/testfiles/analysis/spillage/WAVECAR.nosoc"
wf_so = "../../tests/testfiles/analysis/spillage/WAVECAR.soc"
spl = Spillage(wf_noso=wf_noso, wf_so=wf_so)
info = spl.overlap_so_spinpol()
print(info["spillage"])
"""